CymitQuimica logo

CAS 111649-72-0

:

p-Fluoro-a-acetamidocinnamic Acid

Description:
p-Fluoro-α-acetamidocinnamic acid is an organic compound characterized by its unique structural features, which include a cinnamic acid backbone with a fluorine atom and an acetamido group attached to the para position of the aromatic ring. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the acetamido group. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. p-Fluoro-α-acetamidocinnamic acid may be of interest in pharmaceutical research, particularly in the development of compounds with specific biological activities. Its synthesis and characterization would involve standard organic chemistry techniques, including functional group transformations and purification methods. As with many organic compounds, safety precautions should be observed when handling this substance, and its stability under various conditions should be assessed for practical applications.
Formula:C11H10FNO3
InChI:InChI=1/C11H10FNO3/c1-7(14)13-10(11(15)16)6-8-2-4-9(12)5-3-8/h2-6H,1H3,(H,13,14)(H,15,16)/b10-6-
SMILES:CC(=N/C(=C\c1ccc(cc1)F)/C(=O)O)O
Synonyms:
  • (2Z)-2-(acetylamino)-3-(4-fluorophenyl)prop-2-enoic acid
  • p-Fluoro-α-acetamidocinnamic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.