
CAS 111651-48-0
:Propanoic acid, 3-azido-2-hydroxy-, (2R)-
Description:
Propanoic acid, 3-azido-2-hydroxy-, (2R)-, with the CAS number 111651-48-0, is an organic compound characterized by the presence of a propanoic acid backbone, an azido group (-N3), and a hydroxyl group (-OH) at specific positions on the carbon chain. As a chiral molecule, it exists in two enantiomeric forms, with the (2R) designation indicating the configuration of the chiral center. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds due to the hydroxyl group. The azido group introduces unique reactivity, making it a potential candidate for various chemical transformations, including click chemistry. Its solubility in polar solvents and potential applications in organic synthesis, pharmaceuticals, and materials science are noteworthy. However, safety considerations are essential due to the presence of the azido group, which can be sensitive and potentially explosive under certain conditions. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C3H5N3O3
InChI:InChI=1S/C3H5N3O3/c4-6-5-1-2(7)3(8)9/h2,7H,1H2,(H,8,9)/t2-/m1/s1
InChI key:InChIKey=NEYYWZWMFRJFDX-UWTATZPHSA-N
SMILES:[C@H](C(O)=O)(CN=[N+]=[N-])O
Synonyms:- (2R)-3-Azido-2-hydroxypropanoic acid
- Propanoic acid, 3-azido-2-hydroxy-, (R)-
- Propanoic acid, 3-azido-2-hydroxy-, (2R)-
- (R)-2-Hydroxy-3-azidopropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.