
CAS 111662-72-7
:1-Fluoro-4-(1-methoxyethyl)benzene
Description:
1-Fluoro-4-(1-methoxyethyl)benzene, with the CAS number 111662-72-7, is an organic compound characterized by the presence of a fluorine atom and a methoxyethyl group attached to a benzene ring. This compound features a fluorine substituent at the para position relative to the methoxyethyl group, which influences its chemical reactivity and physical properties. It is typically a colorless to pale yellow liquid with a distinct aromatic odor. The presence of the fluorine atom can enhance the compound's lipophilicity and stability, while the methoxyethyl group may contribute to its solubility in organic solvents. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as an intermediate in chemical reactions. Safety data should be consulted for handling and storage, as it may pose health risks if inhaled or ingested. Overall, 1-Fluoro-4-(1-methoxyethyl)benzene exemplifies the diverse functionalities that can be achieved through strategic molecular design.
Formula:C9H11FO
InChI:InChI=1S/C9H11FO/c1-7(11-2)8-3-5-9(10)6-4-8/h3-7H,1-2H3
InChI key:InChIKey=QJVVITCWTCLUAK-UHFFFAOYSA-N
SMILES:C(OC)(C)C1=CC=C(F)C=C1
Synonyms:- 1-Fluoro-4-(1-methoxyethyl)benzene
- Benzene, 1-fluoro-4-(1-methoxyethyl)-
- 1-(4-Fluorophenyl)ethyl methyl ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Fluoro-4-(1-methoxyethyl)benzene
CAS:<p>1-Fluoro-4-(1-methoxyethyl)benzene</p>Molecular weight:154.18144g/mol

