CAS 111669-24-0

N-Ethyl-2-(1-piperazinyl)-3-pyridinamine

Description:

N-Ethyl-2-(1-piperazinyl)-3-pyridinamine, with the CAS number 111669-24-0, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a piperazine moiety. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as basicity due to the presence of nitrogen atoms in its structure. It is often studied for its potential biological activities, particularly in the field of medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals. The presence of the ethyl group and the piperazine ring can influence its solubility, lipophilicity, and interaction with biological targets. Additionally, N-Ethyl-2-(1-piperazinyl)-3-pyridinamine may exhibit specific reactivity patterns typical of amines, such as nucleophilic substitution and hydrogen bonding, which can be relevant in various chemical reactions and applications. Overall, this compound represents a significant interest in research due to its potential therapeutic applications and unique chemical properties.

Formula: C₁₁H₁₈N₄

InChI: InChI=1S/C11H18N4/c1-2-13-10-4-3-5-14-11(10)15-8-6-12-7-9-15/h3-5,12-13H,2,6-9H2,1H3

InChI key: InChIKey=ACCRDWKRCKTUDR-UHFFFAOYSA-N

SMILES: N(CC)C1=C(N=CC=C1)N2CCNCC2

Synonyms:

• 3-(Ethylamino)-2-(1-piperazinyl)pyridine
• U 76556
• N-Ethyl-2-(1-piperazinyl)-3-pyridinamine
• 3-Pyridinamine, N-ethyl-2-(1-piperazinyl)-