CAS 111688-85-8
:cyclo(lysyl-prolyl)
Description:
Cyclo(lysyl-prolyl) is a cyclic dipeptide composed of the amino acids lysine and proline. This compound features a unique cyclic structure that can influence its biological activity and stability compared to linear peptides. The presence of lysine, which contains an amino group, contributes to potential interactions with other biomolecules, while proline's distinctive ring structure can impart rigidity and influence the peptide's conformation. Cyclo(lysyl-prolyl) may exhibit various properties, such as solubility in polar solvents, and its cyclic nature can enhance resistance to enzymatic degradation, making it of interest in pharmaceutical and biochemical applications. Additionally, cyclic dipeptides often demonstrate unique biological activities, including antimicrobial and antioxidant properties, which can be attributed to their structural characteristics. The specific interactions and effects of cyclo(lysyl-prolyl) would depend on its concentration, environment, and the presence of other compounds. Overall, this substance represents a fascinating area of study within peptide chemistry and its potential applications in medicine and biotechnology.
Formula:C11H19N3O2
InChI:InChI=1/C11H19N3O2/c12-6-2-1-4-8-11(16)14-7-3-5-9(14)10(15)13-8/h8-9H,1-7,12H2,(H,13,15)/t8-,9-/m0/s1
Synonyms:- (3S,8aS)-3-(4-aminobutyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
- Cyclo(lysyl-prolyl)
- Cyclo(lys-pro)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Cyclo(Lys-Pro)
CAS:<p>Cyclo(Lys-Pro) is a cyclic peptide that is stabilized by hydrogen bonding. Cyclo(Lys-Pro) binds to the active site of protein kinase A, which prevents the phosphorylation and activation of other proteins. Cyclo(Lys-Pro) has been shown to stabilize proteins and inhibit the formation of amyloid plaques in Alzheimer's disease. The 6-Fluoro-3-indoxyl-beta-D-galactopyranoside is an antituberculosis drug that belongs to the class of rifamycins. It is the most active of the rifamycins for the treatment of tuberculosis. Rifapentine inhibits bacterial growth by binding to DNA dependent RNA polymerase, thereby preventing transcription and replication. The high frequency of human activity has been shown using a patch clamp technique on human erythrocytes. This active form is metabolized through a number of metabolic transformations,</p>Formula:C11H19N3O2Purity:Min. 95%Molecular weight:225.29 g/mol
