CAS 111689-01-1
:HEPTAKIS-(2 3 6-TRI-O-ETHYL)-BETA-
Description:
Heptakis-(2,3,6-tri-O-ethyl)-beta-cyclodextrin is a modified cyclodextrin, which is a cyclic oligosaccharide composed of glucose units. This particular compound features three ethyl groups attached to the hydroxyl positions at the 2, 3, and 6 positions of the beta-cyclodextrin structure, enhancing its solubility and hydrophobicity compared to native cyclodextrins. The modification allows for improved encapsulation properties, making it useful in various applications, including drug delivery, food technology, and analytical chemistry. The ethyl groups increase the lipophilicity of the molecule, facilitating the inclusion of hydrophobic guest molecules within its cavity. This characteristic is particularly valuable in pharmaceutical formulations, where it can enhance the bioavailability of poorly soluble drugs. Additionally, the compound exhibits low toxicity and good biocompatibility, making it suitable for use in biological systems. Overall, heptakis-(2,3,6-tri-O-ethyl)-beta-cyclodextrin is a versatile compound with significant potential in various fields due to its unique structural properties and functional capabilities.
Formula:C84H154O35
InChI:InChI=1/C84H154O35/c1-22-85-43-50-57-64(92-29-8)71(99-36-15)78(106-50)114-58-51(44-86-23-2)108-80(73(101-38-17)65(58)93-30-9)116-60-53(46-88-25-4)110-82(75(103-40-19)67(60)95-32-11)118-62-55(48-90-27-6)112-84(77(105-42-21)69(62)97-34-13)119-63-56(49-91-28-7)111-83(76(104-41-20)70(63)98-35-14)117-61-54(47-89-26-5)109-81(74(102-39-18)68(61)96-33-12)115-59-52(45-87-24-3)107-79(113-57)72(100-37-16)66(59)94-31-10/h50-84H,22-49H2,1-21H3/t50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64+,65+,66+,67+,68+,69+,70+,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,84-/m1/s1
Synonyms:- 2,3,6-Tri-O-Ethyl-Β-Cyclodextrin
- Heptakis-(2,3,6-Tri-O-Ethyl)-Β-Cyclodextrin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Heptakis(2,3,6-tri-O-ethyl)cyclomaltoheptaose
CAS:<p>This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.</p>Formula:C84H154O35Purity:Min. 95%Molecular weight:1,724.1 g/mol
