CAS 1117-33-5
:4-Octanamine
Description:
4-Octanamine, also known as 1-amino-4-octane, is an organic compound characterized by its amine functional group attached to a straight-chain octane backbone. It has the molecular formula C8H19N, indicating it contains eight carbon atoms, nineteen hydrogen atoms, and one nitrogen atom. This compound is typically a colorless to pale yellow liquid at room temperature and possesses a distinct amine odor. 4-Octanamine is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic alkyl chain. It is primarily used in the synthesis of surfactants, lubricants, and as a building block in organic synthesis. The presence of the amine group allows for reactivity in various chemical reactions, including alkylation and acylation. Safety considerations include its potential to cause irritation upon contact with skin or eyes, and appropriate handling measures should be taken to minimize exposure. Overall, 4-Octanamine is a versatile compound with applications in both industrial and research settings.
Formula:C8H19N
InChI:InChI=1S/C8H19N/c1-3-5-7-8(9)6-4-2/h8H,3-7,9H2,1-2H3
InChI key:InChIKey=PSBKYMODPYHLAW-UHFFFAOYSA-N
SMILES:C(CCCC)(CCC)N
Synonyms:- 4-Octanamine
- 4-Aminooctane
- Pentylamine, 1-propyl-
- 4-Octylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Octan-4-amine
CAS:<p>Octan-4-amine is a metastable cation that has been used as a label for deuterium in various studies. The labeling of octan-4-amine with deuterium has been shown to produce stable, nonradioactive isotopes for use in various studies. It has also been shown to be an effective radical cations and cleavage agent. As a result, it can be used to generate molecular ions and isomers from larger molecules. Octan-4-amine is also capable of isomerizing other compounds and generating radical cations when heated. This chemical may be used as a precursor to create other compounds through the process of isomerization, such as the production of isomers by the addition of hydrogen atoms or removal of hydrogens from their molecular structure.</p>Formula:C8H19NPurity:Min. 95%Molecular weight:129.24 g/mol
