CymitQuimica logo

CAS 111712-56-2

:

5-(2-trifluoroacetylaminohexafluoroprop-2-yl)-2'-deoxyuridine

Description:
5-(2-Trifluoroacetylaminohexafluoroprop-2-yl)-2'-deoxyuridine, with the CAS number 111712-56-2, is a modified nucleoside that incorporates a trifluoroacetylamino group and a hexafluoropropyl moiety into the deoxyuridine structure. This compound is characterized by its unique fluorinated substituents, which can significantly influence its chemical properties, such as solubility, stability, and reactivity. The presence of multiple fluorine atoms typically enhances lipophilicity and can affect the compound's interaction with biological systems, potentially leading to altered pharmacokinetics and bioactivity. As a nucleoside analog, it may exhibit antiviral or anticancer properties, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological assays would be crucial for understanding its potential therapeutic applications. Overall, this compound represents a class of modified nucleosides that are valuable in research and pharmaceutical contexts.
Formula:C14H12F9N3O6
InChI:InChI=1/C14H12F9N3O6/c15-12(16,17)9(30)25-11(13(18,19)20,14(21,22)23)4-1-24-10(31)26(2-4)8-7(29)6(28)5(3-27)32-8/h1-2,5-8,27-29H,3H2,(H,25,30)/t5-,6-,7-,8-/m1/s1
SMILES:c1c(cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)n1)C(C(F)(F)F)(C(F)(F)F)N=C(C(F)(F)F)O
Synonyms:
  • 2'-Deoxy-5-(2,2,2-trifluoro-1-((trifluoroacetyl)amino)-1-(trifluoromethyl)ethyl)uridine
  • 2'-Deoxy-5-(2-trifluoroacetylaminohexafluoroprop-2-yl)uridine
  • 5-Thfpdu
  • Uridine, 2'-deoxy-5-(2,2,2-trifluoro-1-((trifluoroacetyl)amino)-1-(trifluoromethyl)ethyl)-
  • 1-beta-D-ribofuranosyl-5-{2,2,2-trifluoro-1-[(trifluoroacetyl)amino]-1-(trifluoromethyl)ethyl}pyrimidin-2(1H)-one
  • 5-(2-Trifluoroacetylaminohexafluoroprop-2-yl)-2'-deoxyuridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.