CAS 111738-35-3
:4-(4-fluorophenyl)thiomethyl-5-methyl-1,3-dioxol-2-one
Description:
4-(4-Fluorophenyl)thiomethyl-5-methyl-1,3-dioxol-2-one, with the CAS number 111738-35-3, is a chemical compound characterized by its unique structural features, including a dioxolane ring and a thiomethyl group. The presence of the fluorophenyl substituent suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. This compound may exhibit specific reactivity patterns typical of dioxolones, such as susceptibility to nucleophilic attack or involvement in cyclization reactions. Its thiomethyl group can also impart distinct chemical properties, potentially enhancing solubility or altering metabolic pathways. The compound's stability, solubility, and reactivity can be influenced by the electronic effects of the fluorine atom and the overall molecular geometry. As with many organic compounds, its behavior in various solvents and under different conditions would be essential for understanding its practical applications and interactions in chemical processes.
Formula:C11H9FO3S
InChI:InChI=1/C11H9FO3S/c1-7-10(15-11(13)14-7)6-16-9-4-2-8(12)3-5-9/h2-5H,6H2,1H3
SMILES:Cc1c(CSc2ccc(cc2)F)oc(=O)o1
Synonyms:- Ftmdo
- 4-{[(4-Fluorophenyl)Sulfanyl]Methyl}-5-Methyl-1,3-Dioxol-2-One
- 4-(4-Fluorophenyl)thiomethyl-5-methyl-1,3-dioxol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.