CAS 111758-60-2
:Methyl 2-(3-iodophenoxy)acetate
Description:
Methyl 2-(3-iodophenoxy)acetate, with the CAS number 111758-60-2, is an organic compound characterized by its ester functional group, which is derived from the reaction of methyl alcohol and 2-(3-iodophenoxy)acetic acid. This compound typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the iodophenyl group. It has a moderate molecular weight and exhibits solubility in organic solvents, making it useful in various chemical applications. The presence of iodine in its structure may impart unique reactivity, particularly in nucleophilic substitution reactions. Methyl 2-(3-iodophenoxy)acetate can be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as an intermediate. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate personal protective equipment to avoid inhalation or skin contact. Overall, its chemical properties make it a valuable compound in synthetic organic chemistry.
Formula:C9H9IO3
InChI:InChI=1S/C9H9IO3/c1-12-9(11)6-13-8-4-2-3-7(10)5-8/h2-5H,6H2,1H3
InChI key:InChIKey=RPOYXMRWAUQVML-UHFFFAOYSA-N
SMILES:O(CC(OC)=O)C1=CC(I)=CC=C1
Synonyms:- Methyl 3-Iodophenoxyacetate
- Methyl 2-(3-iodophenoxy)acetate
- Acetic acid, 2-(3-iodophenoxy)-, methyl ester
- Acetic acid, (3-iodophenoxy)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.