CAS 111758-82-8

7-METHOXY-1,2,3,4-TETRAHYDRO-NAPHTHALEN-1-YLAMINE HYDROCHLORIDE

Description:

7-Methoxy-1,2,3,4-tetrahydro-naphthalen-1-ylamine hydrochloride is a chemical compound characterized by its structural features, which include a tetrahydronaphthalene core substituted with a methoxy group and an amine functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the methoxy group contributes to its potential biological activity, as methoxy-substituted compounds often exhibit interesting pharmacological properties. The amine functional group can participate in hydrogen bonding and may influence the compound's reactivity and interaction with biological targets. This substance is primarily used in research settings, particularly in medicinal chemistry, where it may serve as a lead compound for the development of new therapeutic agents. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.

Formula: C₁₁H₁₆ClNO

InChI: InChI=1/C11H15NO.ClH/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9;/h5-7,11H,2-4,12H2,1H3;1H

SMILES: COc1ccc2CCCC(c2c1)N.Cl

Synonyms:

• 7-Methoxy-1,2,3,4-Tetrahydronaphthalen-1-Amine Hydrochloride

7-Methoxy-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride

CAS: 111758-82-8

Formula: C₁₁H₁₆ClNO

Molecular weight: 213.7038

Ref: IN-DA0081SY

7-Methoxy-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride

CAS: 111758-82-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.7 g/mol

Ref: 3D-LEA75882