CAS 111760-38-4
:2-(3-Thienyl)piperazine
Description:
2-(3-Thienyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms at opposite positions. The compound features a thienyl group, derived from thiophene, attached to the piperazine ring. This thienyl substituent contributes to the compound's unique properties, including its potential for biological activity. The presence of sulfur in the thiophene ring can influence the compound's electronic properties and reactivity. 2-(3-Thienyl)piperazine is often studied in medicinal chemistry for its potential applications in pharmacology, particularly in the development of psychoactive drugs and as a scaffold for various therapeutic agents. Its solubility, stability, and interaction with biological targets are key characteristics that researchers evaluate when exploring its utility in drug design. Additionally, the compound's structural features may allow for specific interactions with receptors or enzymes, making it a subject of interest in the study of neuropharmacology and related fields.
Formula:C8H12N2S
InChI:InChI=1S/C8H12N2S/c1-4-11-6-7(1)8-5-9-2-3-10-8/h1,4,6,8-10H,2-3,5H2
InChI key:InChIKey=CNCNNYFNOXHYAC-UHFFFAOYSA-N
SMILES:C=1(C=CSC1)C2CNCCN2
Synonyms:- 2-(3-Thienyl)piperazine
- 2-(3-Thienyl)piperazine, 95%
- 2-Thiophen-3-ylpiperazine
- Piperazine, 2-(3-thienyl)-
- 2-Thiophen-3-yl-piperazine
- 2-(Thiophen-3-yl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
