CymitQuimica logo

CAS 111770-87-7

:

5-Bromo-2-pyridinepropanol

Description:
5-Bromo-2-pyridinepropanol, with the CAS number 111770-87-7, is a chemical compound characterized by its structure, which includes a bromine atom and a pyridine ring. This compound typically exhibits properties associated with both alcohols and heterocyclic compounds. The presence of the hydroxyl (-OH) group suggests it can participate in hydrogen bonding, influencing its solubility in polar solvents like water. The bromine substituent may impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the pyridine moiety can contribute to the compound's aromaticity and may affect its electronic properties, making it useful in medicinal chemistry and as an intermediate in organic synthesis. The compound's stability, reactivity, and potential applications can vary based on the specific conditions under which it is used, including temperature, pH, and the presence of other reagents. Overall, 5-Bromo-2-pyridinepropanol is of interest in both academic research and industrial applications due to its unique structural features.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c9-7-3-4-8(10-6-7)2-1-5-11/h3-4,6,11H,1-2,5H2
InChI key:InChIKey=OEYNYBDLBSGKRU-UHFFFAOYSA-N
SMILES:C(CCO)C1=CC=C(Br)C=N1
Synonyms:
  • 5-Bromo-2-pyridinepropanol
  • 3-(5-Bromopyridin-2-yl)propan-1-ol
  • 2-Pyridinepropanol, 5-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.