CAS 111771-08-5
:2-FLUORO-6-IODOBENZOIC ACID
Description:
2-Fluoro-6-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both fluorine and iodine substituents on the benzene ring. The fluorine atom is located at the 2-position, while the iodine atom is at the 6-position relative to the carboxylic acid group. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its molecular structure contributes to its unique reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of halogens can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the carboxylic acid functional group allows for hydrogen bonding, which can affect its solubility and interaction with other molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-fluoro-6-iodobenzoic acid is a valuable compound in organic chemistry with diverse applications.
Formula:C7H3FIO2
InChI:InChI=1/C7H4FIO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11)/p-1
SMILES:c1cc(c(c(c1)I)C(=O)[O-])F
Synonyms:- Rarechem Al Bo 0280
- Timtec-Bb Sbb006699
- 2-Fluoro-6-iodobenzoic
- 2-Fluoro-6-iodobenzoic acid 98%
- 2-Fluoro-6-iodobenzoicacid98%
- 2-Fluoro-6-Iodobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-6-iodobenzoic Acid
CAS:Formula:C7H4FIO2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:266.012-Fluoro-6-iodobenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H3FIO2Purity:97%Color and Shape:White to cream to yellow to pale brown, PowderMolecular weight:265.002-Fluoro-6-iodobenzoic acid
CAS:Formula:C7H4FIO2Purity:98%Color and Shape:SolidMolecular weight:266.00832-Fluoro-6-iodobenzoic acid
CAS:2-Fluoro-6-iodobenzoic acidFormula:C7H4FIO2Purity:98%Color and Shape: light orange/brown powderMolecular weight:266.01g/mol2-Fluoro-6-iodobenzoic acid
CAS:Formula:C7H4FIO2Purity:98%Color and Shape:SolidMolecular weight:266.01




