CAS 111781-56-7: 2-(3-Pyridinyl)piperazine

Description:2-(3-Pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a pyridine ring substituted at the 3-position, contributing to its unique properties and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is indicative of its ability to engage in hydrogen bonding due to the presence of nitrogen atoms. The compound is of interest in medicinal chemistry, particularly for its potential applications in the development of pharmaceuticals, as it may interact with various biological targets, including neurotransmitter receptors. Its structure allows for diverse modifications, which can enhance its pharmacological profile. Additionally, 2-(3-Pyridinyl)piperazine may exhibit properties such as basicity due to the nitrogen atoms, influencing its reactivity and interactions in chemical processes. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.

Formula:C₉H₁₃N₃

InChI:InChI=1S/C9H13N3/c1-2-8(6-10-3-1)9-7-11-4-5-12-9/h1-3,6,9,11-12H,4-5,7H2

InChI key:InChIKey=CGUDKJYHYOYXAQ-UHFFFAOYSA-N

SMILES:N=1C=CC=C(C1)C2NCCNC2

Synonyms:
Piperazine, 2-(3-pyridinyl)-
2-(3-Pyridinyl)piperazine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Piperazine, 2-(3-pyridinyl)- REF: IN-DA0081RBCAS: 111781-56-7	- - -	To inquire	Mon 14 Apr 25
2-Pyridin-3-ylpiperazine REF: 10-F306632CAS: 111781-56-7	95.0%	To inquire	Thu 24 Apr 25
2-Pyridin-3-ylpiperazine REF: 3D-FP180336CAS: 111781-56-7	Min. 95%	- - -	Discontinued product