CAS 111787-82-7

ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate

Description:

Ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate, with the CAS number 111787-82-7, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a chlorophenyl substituent. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the 4-chlorophenyl group suggests that it may exhibit interesting electronic properties and biological activity, making it a candidate for further research in drug development. Its molecular structure indicates that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the reactivity of the carbonyl groups. Additionally, the compound's solubility and stability can vary based on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate is a noteworthy compound in the field of organic chemistry.

Formula: C₁₄H₁₅ClO₄

InChI: InChI=1/C14H15ClO4/c1-3-19-14(18)12(9(2)16)8-13(17)10-4-6-11(15)7-5-10/h4-7,12H,3,8H2,1-2H3

SMILES: CCOC(=O)C(CC(=O)c1ccc(cc1)Cl)C(=O)C

ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate

CAS: 111787-82-7

ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate

Purity: ≥95%

Ref: 54-OR29469

Ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate

CAS: 111787-82-7

Versatile small molecule scaffold

Formula: C₁₄H₁₅ClO₄

Purity: Min. 95%

Molecular weight: 282.72 g/mol

Ref: 3D-LEA78782