CAS 111787-86-1
:2-METHYL-5-(4-METHYLPHENYL)-3-FUROIC ACID
Description:
2-Methyl-5-(4-methylphenyl)-3-furoic acid is an organic compound characterized by its furoic acid structure, which includes a furan ring and a carboxylic acid functional group. This compound features a methyl group and a para-substituted methylphenyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water can vary. The presence of the furan ring suggests potential reactivity, particularly in electrophilic substitution reactions. Additionally, the compound may display interesting biological activities, making it of interest in pharmaceutical and material science research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different environments. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 2-methyl-5-(4-methylphenyl)-3-furoic acid is a compound of interest due to its structural features and potential applications.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-8-3-5-10(6-4-8)12-7-11(13(14)15)9(2)16-12/h3-7H,1-2H3,(H,14,15)
SMILES:Cc1ccc(cc1)c1cc(c(C)o1)C(=O)O
Synonyms:- 2-Methyl-5-(4-Methylphenyl)Furan-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.