CAS 111787-87-2

5-(4-Methoxyphenyl)-2-methyl-3-furancarboxylic acid

Description:

5-(4-Methoxyphenyl)-2-methyl-3-furancarboxylic acid, with the CAS number 111787-87-2, is an organic compound characterized by its unique structural features, which include a furan ring and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of carboxylic acid functional groups. The methoxy group can influence its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the furan ring contributes to its aromaticity and may participate in various chemical reactions, including oxidation and polymerization. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its specific melting point, boiling point, and spectral data would provide further insights into its physical and chemical properties, but these details are typically determined through experimental methods. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₃H₁₂O₄

InChI: InChI=1S/C13H12O4/c1-8-11(13(14)15)7-12(17-8)9-3-5-10(16-2)6-4-9/h3-7H,1-2H3,(H,14,15)

InChI key: InChIKey=AQZLIAGPNPFISZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(OC1C)C2=CC=C(OC)C=C2

Synonyms:

• 5-(4-Methoxyphenyl)-2-methyl-3-furancarboxylic acid
• 3-Furancarboxylic acid, 5-(4-methoxyphenyl)-2-methyl-
• 2-Methyl-5-(4-methoxyphenyl)furan-3-carboxylic acid