CAS 111787-88-3: 5-(4-Fluorophenyl)-2-methyl-3-furancarboxylic acid
Description:5-(4-Fluorophenyl)-2-methyl-3-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring, a carboxylic acid group, and a fluorophenyl substituent. The presence of the fluorine atom on the phenyl ring enhances its lipophilicity and can influence its biological activity. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic carboxylic acids. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or analgesic properties. The furan moiety may also contribute to its reactivity and interaction with biological targets. Additionally, the compound's stability under standard conditions makes it suitable for various synthetic applications. As with many organic compounds, safety precautions should be taken when handling it, as it may pose risks such as irritation or toxicity. Overall, 5-(4-Fluorophenyl)-2-methyl-3-furancarboxylic acid is a compound of interest in both synthetic and medicinal chemistry.
Formula:C12H9FO3
InChI:InChI=1S/C12H9FO3/c1-7-10(12(14)15)6-11(16-7)8-2-4-9(13)5-3-8/h2-6H,1H3,(H,14,15)
InChI key:InChIKey=NGJWATPYRGMGHI-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(OC1C)C=2C=CC(F)=CC2
- Synonyms:
- 3-Furancarboxylic Acid, 5-(4-Fluorophenyl)-2-Methyl-
- 5-(4-Fluorophenyl)-2-Methylfuran-3-Carboxylic Acid
- 5-(4-Fluorophenyl)-2-methyl-3-furancarboxylic acid
- 5-(4-Fluorophenyl)-2-methyl-3-furoic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-(4-Fluorophenyl)-2-methylfuran-3-carboxylic acid REF: 54-PC446122CAS: 111787-88-3 | 95+% | 560.00 € | Tue 04 Mar 25 |
 | 5-(4-Fluoro-phenyl)-2-methyl-furan-3-carboxylic acid REF: 10-F475729CAS: 111787-88-3 | 95.0% | To inquire | Thu 13 Mar 25 |
 | 5-(4-Fluorophenyl)-2-methyl-3-furoic acid REF: 3D-FF86326CAS: 111787-88-3 | Min. 95% | - - - | Discontinued product |
5-(4-Fluorophenyl)-2-methylfuran-3-carboxylic acid
Ref: 54-PC446122
| 1g | 560.00 € |
5-(4-Fluoro-phenyl)-2-methyl-furan-3-carboxylic acid
Ref: 10-F475729
| 1g | To inquire | ||
| 250mg | To inquire |
5-(4-Fluorophenyl)-2-methyl-3-furoic acid
Ref: 3D-FF86326
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
