CAS 111787-91-8: (2-methyl-5-phenyl-3-furyl)methanol

Description: (2-Methyl-5-phenyl-3-furyl)methanol, with the CAS number 111787-91-8, is an organic compound characterized by its unique structural features, including a furan ring substituted with a methyl group and a phenyl group, along with a hydroxymethyl functional group. This compound exhibits properties typical of both aromatic and heterocyclic compounds, which may influence its reactivity and solubility. It is likely to be a solid at room temperature, given the presence of multiple aromatic systems that contribute to its stability. The hydroxymethyl group suggests potential for hydrogen bonding, which can affect its boiling point and solubility in polar solvents. Additionally, the presence of the furan ring may impart some degree of reactivity, particularly in electrophilic substitution reactions. Overall, (2-methyl-5-phenyl-3-furyl)methanol is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules.

Formula: C₁₂H₁₂O₂

InChI: InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3

Synonyms:

• (2-Methyl-5-Phenylfuran-3-Yl)Methanol

3-(Hydroxymethyl)-2-methyl-5-phenylfuran

CAS: 111787-91-8

• Molecular weight: 188.22g/mol

(2-Methyl-5-phenyl-furan-3-yl)-methanol

CAS: 111787-91-8

• Purity: 95.0%
• Color and Shape: Liquid, Oil
• Molecular weight: 188.2259979248047