CAS 1118-15-6
:1,1,3,3-Tetramethyl-1,3-disiloxanediol
Description:
1,1,3,3-Tetramethyl-1,3-disiloxanediol, with the CAS number 1118-15-6, is a siloxane compound characterized by its unique structure that includes silicon-oxygen bonds. This compound features two silicon atoms, each bonded to two methyl groups and a hydroxyl group, contributing to its diol classification. It is typically a colorless to pale yellow liquid with low viscosity, exhibiting good thermal stability and resistance to moisture. The presence of hydroxyl groups imparts hydrophilic properties, while the methyl groups enhance its hydrophobic characteristics, making it useful in various applications, including as a silicone-based surfactant or in formulations requiring surface-active agents. Additionally, its siloxane backbone provides flexibility and durability, which are advantageous in materials science and polymer chemistry. The compound is generally considered to have low toxicity, but standard safety precautions should be observed when handling it in laboratory or industrial settings. Overall, 1,1,3,3-Tetramethyl-1,3-disiloxanediol is valued for its unique chemical properties and versatility in various chemical applications.
Formula:C4H14O3Si2
InChI:InChI=1S/C4H14O3Si2/c1-8(2,5)7-9(3,4)6/h5-6H,1-4H3
InChI key:InChIKey=PFEAZKFNWPIFCV-UHFFFAOYSA-N
SMILES:O([Si](C)(C)O)[Si](C)(C)O
Synonyms:- 1,1,3,3-Tetramethyl-1,3-dihydroxydisiloxane
- 1,1,3,3-Tetramethyl-1,3-disiloxanediol
- 1,3-Dihydroxy-1,1,3,3-tetramethyl-1,3-disiloxane
- 1,3-Dihydroxy-1,1,3,3-tetramethyldisiloxane
- 1,3-Dihydroxytetramethyldisiloxane
- 1,3-Disiloxanediol, 1,1,3,3-tetramethyl-
- 1,3-Disiloxanediol, tetramethyl-
- 1,3-Disiloxanediol, tetramethyl- (6CI,7CI)
- Tetramethyldisiloxane-1,3-diol
- Tetramethyldisiloxanediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,1,3,3-Tetramethyl-1,3-dihydroxydisiloxane
CAS:Formula:C4H14O3Si2Purity:96%Color and Shape:LiquidMolecular weight:166.3232Simethicone Impurity 2
CAS:Formula:C4H14O3Si2Color and Shape:White To Off-White SolidMolecular weight:166.321,1,3,3-Tetramethyldisiloxane-1,3-diol
CAS:1,1,3,3-Tetramethyldisiloxane-1,3-diol is a chemical compound with the formula (CH(SiO)H). It is a liquid that is soluble in organic solvents. It has been used as a phase-transfer catalyst in clinical research for proliferative diabetic retinopathy. 1,1,3,3-Tetramethyldisiloxane-1,3-diol has been shown to be an efficient plasma mass spectrometry probe for covid-19 pandemic. This chemical compound has also been found to be an effective treatment against prostate cancer cells due to its ring opening and hydrogen chloride catalytic properties. 1,1,3,3-Tetramethyldisiloxane-1,3-diol is synthesized from tetramethyldisiloxane and methanol using acid as a catalyst. The main functional groups of this molecule are
Formula:C4H14O3Si2Purity:Min. 95%Color and Shape:PowderMolecular weight:166.32 g/mol



