CAS 111823-36-0

bromo-[(3,5-dimethylphenyl)methyl]magnesium

Description:

Bromo-[(3,5-dimethylphenyl)methyl]magnesium, with the CAS number 111823-36-0, is an organomagnesium compound commonly classified as a Grignard reagent. This compound features a magnesium atom bonded to a bromo group and a 3,5-dimethylphenylmethyl group, which contributes to its reactivity and utility in organic synthesis. Grignard reagents are known for their nucleophilic properties, allowing them to react with a variety of electrophiles, including carbonyl compounds, to form alcohols. The presence of the bulky 3,5-dimethylphenyl group can influence the steric and electronic properties of the reagent, potentially affecting its reactivity and selectivity in reactions. Typically, Grignard reagents are sensitive to moisture and air, requiring an anhydrous environment for storage and use. They are often utilized in the formation of carbon-carbon bonds, making them valuable in the synthesis of complex organic molecules. Proper handling and safety precautions are essential due to their highly reactive nature.

Formula: C₉H₁₁BrMg

InChI: InChI=1/C9H11.BrH.Mg/c1-7-4-8(2)6-9(3)5-7;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11BrMg/c1-7-3-8(2)5-9(4-7)6-11-10/h3-5H,6H2,1-2H3

SMILES: C=C1C=C(C)[CH]C(=C1)C.Br.[Mg]