CAS 111830-58-1
:1,5-Anhydro-2-deoxy-3,6-bis-O-[(1,1-dimethylethyl)dimethylsilyl]-4-O-(phenylmethyl)-D-arabino-hex-1-enitol
Description:
1,5-Anhydro-2-deoxy-3,6-bis-O-[(1,1-dimethylethyl)dimethylsilyl]-4-O-(phenylmethyl)-D-arabino-hex-1-enitol, with CAS number 111830-58-1, is a complex organic compound characterized by its unique structural features, including multiple functional groups and protective silyl groups. This compound is a derivative of D-arabino-hex-1-enitol, which indicates it has a hexose backbone with specific stereochemistry. The presence of an anhydro sugar moiety suggests it may exhibit properties related to carbohydrate chemistry, such as potential reactivity in glycosylation reactions. The silyl groups provide stability and protect hydroxyl functionalities, making the compound useful in synthetic organic chemistry, particularly in the synthesis of more complex molecules. Additionally, the phenylmethyl group may enhance lipophilicity and influence the compound's solubility and reactivity. Overall, this compound is of interest in research and applications involving carbohydrate derivatives and may serve as an intermediate in the synthesis of biologically active molecules.
Formula:C25H44O4Si2
InChI:InChI=1S/C25H44O4Si2/c1-24(2,3)30(7,8)28-19-22-23(27-18-20-14-12-11-13-15-20)21(16-17-26-22)29-31(9,10)25(4,5)6/h11-17,21-23H,18-19H2,1-10H3/t21-,22-,23+/m1/s1
InChI key:InChIKey=CZGTZYNJABAJPH-ZLNRFVROSA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@H](O[Si](C(C)(C)C)(C)C)C=CO[C@@H]2CO[Si](C(C)(C)C)(C)C
Synonyms:- 1,5-Anhydro-2-deoxy-3,6-bis-O-[(1,1-dimethylethyl)dimethylsilyl]-4-O-(phenylmethyl)-D-arabino-hex-1-enitol
- D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-3,6-bis-O-[(1,1-dimethylethyl)dimethylsilyl]-4-O-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.