CymitQuimica logo

CAS 111860-00-5

:

2-BROMO-5-METHYL-1-BENZOTHIOPHENE

Description:
2-Bromo-5-methyl-1-benzothiophene is an organic compound characterized by its unique structure, which includes a benzothiophene core substituted with a bromine atom and a methyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The methyl group enhances the compound's hydrophobicity and can influence its electronic properties, affecting its behavior in biological systems and chemical reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the functional groups present and the overall molecular structure. Additionally, the compound's potential applications in materials science and pharmaceuticals are of interest, particularly in the development of new materials or therapeutic agents. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C9H7BrS
InChI:InChI=1/C9H7BrS/c1-6-2-3-8-7(4-6)5-9(10)11-8/h2-5H,1H3
SMILES:Cc1ccc2c(c1)cc(Br)s2
Synonyms:
  • Buttpark 99\04-85
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.