CAS 111873-33-7

Tetrabutylammonium heptadecafluorooctanesulfonate

Description:

Tetrabutylammonium heptadecafluorooctanesulfonate (CAS 111873-33-7) is a quaternary ammonium salt characterized by its long-chain fluorinated sulfonate group. This compound features a tetrabutylammonium cation, which consists of four butyl groups attached to a nitrogen atom, and a heptadecafluorooctanesulfonate anion, known for its high hydrophobicity and lipophobicity due to the presence of multiple fluorine atoms. The fluorinated tail imparts unique properties, such as thermal stability and resistance to chemical degradation, making it useful in various applications, including as a surfactant and in the formulation of specialty chemicals. Additionally, it exhibits low surface tension and can enhance the solubility of hydrophobic compounds in aqueous solutions. However, due to the environmental persistence of fluorinated compounds, there are concerns regarding their ecological impact, leading to increased scrutiny and regulation in many jurisdictions. Overall, tetrabutylammonium heptadecafluorooctanesulfonate is notable for its unique chemical structure and properties, which are leveraged in both industrial and research settings.

Formula: C₁₆H₃₆N·C₈F₁₇O₃S

InChI: InChI=1S/C16H36N.C8HF17O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h5-16H2,1-4H3;(H,26,27,28)/q+1;/p-1

InChI key: InChIKey=MUOQTHSUZGSHGW-UHFFFAOYSA-M

SMILES: C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(S(=O)(=O)[O-])(F)F)(F)F)(F)F)(F)F.[N+](CCCC)(CCCC)(CCCC)CCCC

Synonyms:

• 1-Butanaminium, N,N,N-tributyl-, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonate (1:1)
• 1-Butanaminium, N,N,N-tributyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonic acid (1:1)
• 1-Octanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-, ion(1-), N,N,N-tributyl-1-butanaminium
• Tetrabutylammonium heptadecafluorooctanesulfonate
• Tetrabutylammonium perfluorooctanesulfonate

N,N,N-Tributyl-1-butanaminium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonate

Controlled Product

CAS: 111873-33-7

N,N,N-Tributyl-1-Butanaminium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonate is an organic solvent that belongs to the group of surfactants. It is used as a crosslinking agent and ionizing agent in uncured coatings. This chemical has shown proton conductivity and the ability to generate hydroxyl ions when exposed to radiation such as ultraviolet light or gamma rays. NBDBS has been shown to be an effective antigen for use in immunological assays.

Formula: C₂₄H₃₆F₁₇NO₃S

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 741.59 g/mol

Ref: 3D-FT102242