CAS 111878-47-8
:3-(6-((2-methylene-3-(((octadecylamino)carbonyl)oxy)propoxy)carbonyl)hexyl)thiazolium
Description:
3-(6-((2-methylene-3-(((octadecylamino)carbonyl)oxy)propoxy)carbonyl)hexyl)thiazolium, with CAS number 111878-47-8, is a complex organic compound characterized by its thiazolium ring, which contributes to its potential biological activity. The presence of long-chain alkyl groups, such as octadecyl, suggests that this substance may exhibit amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments. This characteristic is often associated with surfactants or emulsifiers, which can stabilize mixtures of oil and water. Additionally, the methylene and carbonyl functionalities indicate that the compound may participate in various chemical reactions, including esterification and amidation. Its structural complexity implies potential applications in fields such as pharmaceuticals, materials science, or as a biochemical probe. However, specific properties such as solubility, melting point, and reactivity would require empirical data for a comprehensive understanding of its behavior in different environments. Safety and handling considerations should also be taken into account due to the presence of long-chain amines, which can pose risks in certain contexts.
Formula:C33H59N2O4S
InChI:InChI=1/C33H58N2O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21-24-34-33(37)39-29-31(2)28-38-32(36)23-20-17-19-22-25-35-26-27-40-30-35/h26-27,30H,2-25,28-29H2,1H3/p+1
Synonyms:- 3-{7-[(2-{[(octadecylcarbamoyl)oxy]methyl}prop-2-en-1-yl)oxy]-7-oxoheptyl}-1,3-thiazol-3-ium bromide
- 3-(6-((2-Methylene-3-(((octadecylamino)carbonyl)oxy)propoxy)carbonyl)hexyl)thiazolium
- Mocoht
- 3-{7-[(2-{[(octadecylcarbamoyl)oxy]methyl}prop-2-en-1-yl)oxy]-7-oxoheptyl}-1,3-thiazol-3-ium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mocoht bromide
CAS:Mocoht bromide is new antagonists of platelet activating factor.Formula:C33H59BrN2O4SColor and Shape:SolidMolecular weight:659.8
