CAS 1118786-87-0

2,2-Bis(1-methylethyl) 6,6-dimethoxyspiro[3.3]heptane-2,2-dicarboxylate

Description:

2,2-Bis(1-methylethyl) 6,6-dimethoxyspiro[3.3]heptane-2,2-dicarboxylate, identified by its CAS number 1118786-87-0, is a complex organic compound characterized by its spirocyclic structure, which features a unique arrangement of carbon atoms that contributes to its distinctive chemical properties. This compound contains two methoxy groups and two carboxylate functional groups, which can influence its reactivity and solubility in various solvents. The presence of isopropyl groups enhances its hydrophobic characteristics, making it less soluble in polar solvents. Additionally, the spiro structure may impart rigidity to the molecule, potentially affecting its conformational flexibility and interactions with other chemical species. Such compounds are often of interest in fields like materials science and medicinal chemistry due to their potential applications in drug development and as intermediates in synthetic pathways. However, specific data regarding its biological activity, toxicity, and environmental impact would require further investigation and analysis.

Formula: C₁₇H₂₈O₆

InChI: InChI=1S/C17H28O6/c1-11(2)22-13(18)16(14(19)23-12(3)4)7-15(8-16)9-17(10-15,20-5)21-6/h11-12H,7-10H2,1-6H3

InChI key: InChIKey=ZCZRABRYWOITQF-UHFFFAOYSA-N

SMILES: C(OC(C)C)(=O)C1(C(OC(C)C)=O)CC2(C1)CC(OC)(OC)C2

Synonyms:

• 2,2-Bis(1-methylethyl) 6,6-dimethoxyspiro[3.3]heptane-2,2-dicarboxylate
• Spiro[3.3]heptane-2,2-dicarboxylic acid, 6,6-dimethoxy-, 2,2-bis(1-methylethyl) ester

2,2-Bis(propan-2-yl) 6,6-dimethoxyspiro[3.3]heptane-2,2-dicarboxylate

CAS: 1118786-87-0

Versatile small molecule scaffold

Formula: C₁₇H₂₈O₆

Purity: Min. 95%

Molecular weight: 328.4 g/mol

Ref: 3D-TUB78687