
CAS 1118786-92-7
:1-(4-Bromophenyl)-5-chloro-2-(dimethylamino)-1H-imidazole-4-carboxaldehyde
Description:
1-(4-Bromophenyl)-5-chloro-2-(dimethylamino)-1H-imidazole-4-carboxaldehyde is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. The presence of a bromophenyl group and a chloro substituent contributes to its unique reactivity and potential applications in medicinal chemistry. The dimethylamino group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of imidazole derivatives, such as potential antimicrobial or antifungal activity, due to the presence of the imidazole ring, which is known for its role in various biological systems. The aldehyde functional group can participate in further chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the specific halogen substitutions can affect the electronic properties and steric hindrance, influencing the compound's reactivity and interaction with biological targets. Overall, this compound's unique structure suggests potential utility in pharmaceutical research and development.
Formula:C12H11BrClN3O
InChI:InChI=1S/C12H11BrClN3O/c1-16(2)12-15-10(7-18)11(14)17(12)9-5-3-8(13)4-6-9/h3-7H,1-2H3
InChI key:InChIKey=MZCOGNPEHXRVLR-UHFFFAOYSA-N
SMILES:N(C)(C)C=1N(C(Cl)=C(C=O)N1)C2=CC=C(Br)C=C2
Synonyms:- 1-(4-Bromophenyl)-5-chloro-2-(dimethylamino)-1H-imidazole-4-carbaldehyde
- 1-(4-Bromophenyl)-5-chloro-2-(dimethylamino)-1H-imidazole-4-carboxaldehyde
- 1H-Imidazole-4-carboxaldehyde, 1-(4-bromophenyl)-5-chloro-2-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.