CymitQuimica logo

CAS 1118787-00-0

:

2-[[(2-Chlorophenyl)methyl]amino]-1-propanol

Description:
2-[[(2-Chlorophenyl)methyl]amino]-1-propanol, identified by its CAS number 1118787-00-0, is a chemical compound characterized by its structural features, which include a propanol backbone with an amino group and a chlorophenyl substituent. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the chlorophenyl group may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound may exhibit moderate lipophilicity due to the aromatic ring, affecting its pharmacokinetic properties. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. As with many organic compounds, safety and handling precautions are essential, as it may possess toxicological properties that require careful assessment in laboratory settings. Overall, 2-[[(2-Chlorophenyl)methyl]amino]-1-propanol represents a compound with diverse chemical characteristics and potential applications in various fields.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-8(7-13)12-6-9-4-2-3-5-10(9)11/h2-5,8,12-13H,6-7H2,1H3
InChI key:InChIKey=YEZLLBZQPKTYAA-UHFFFAOYSA-N
SMILES:C(NC(CO)C)C1=C(Cl)C=CC=C1
Synonyms:
  • 2-[[(2-Chlorophenyl)methyl]amino]-1-propanol
  • 1-Propanol, 2-[[(2-chlorophenyl)methyl]amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.