CAS 1118787-01-1
:5-(Aminocarbonyl)-1H-pyrrole-3-carboxylic acid
Description:
5-(Aminocarbonyl)-1H-pyrrole-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features both an amino group and a carboxylic acid functional group, contributing to its potential as a building block in pharmaceutical and biochemical applications. The presence of the aminocarbonyl group enhances its reactivity, making it suitable for various synthetic pathways, including peptide synthesis and other organic transformations. Its solubility in polar solvents is typical for compounds containing carboxylic acids and amines, which can facilitate its use in aqueous environments. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. The specific properties, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise characterization. Overall, this compound's unique structure and functional groups position it as a valuable entity in chemical research and development.
Formula:C6H6N2O3
InChI:InChI=1S/C6H6N2O3/c7-5(9)4-1-3(2-8-4)6(10)11/h1-2,8H,(H2,7,9)(H,10,11)
InChI key:InChIKey=KDLHXSJAELVZGR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C(N)=O)NC1
Synonyms:- 1H-Pyrrole-3-carboxylic acid, 5-(aminocarbonyl)-
- 5-(Aminocarbonyl)-1H-pyrrole-3-carboxylic acid
- 5-Carbamoyl-1H-pyrrole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.