CAS 1118787-02-2

2-(3-Aminophenyl)-6-ethyl-4(3H)-pyrimidinone

Description:

2-(3-Aminophenyl)-6-ethyl-4(3H)-pyrimidinone, identified by its CAS number 1118787-02-2, is a chemical compound characterized by its pyrimidinone core structure, which features a pyrimidine ring substituted with an ethyl group and an amino phenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino group, which can participate in hydrogen bonding and enhance solubility in polar solvents. The ethyl substituent may influence the compound's lipophilicity and overall molecular interactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of both aromatic and aliphatic components in its structure may contribute to its stability and reactivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Further studies would be necessary to elucidate its full range of characteristics and potential applications.

Formula: C₁₂H₁₃N₃O

InChI: InChI=1S/C12H13N3O/c1-2-10-7-11(16)15-12(14-10)8-4-3-5-9(13)6-8/h3-7H,2,13H2,1H3,(H,14,15,16)

InChI key: InChIKey=VCGIACRJQWYQEY-UHFFFAOYSA-N

SMILES: C(C)C=1NC(=NC(=O)C1)C2=CC(N)=CC=C2

Synonyms:

• 4(3H)-Pyrimidinone, 2-(3-aminophenyl)-6-ethyl-
• 2-(3-Aminophenyl)-6-ethyl-4(3H)-pyrimidinone