CAS 1118787-06-6

1-[5-(3-Bromophenyl)-2-thienyl]ethanone oxime

Description:

1-[5-(3-Bromophenyl)-2-thienyl]ethanone oxime is an organic compound characterized by its unique structural features, which include a thienyl ring and a bromophenyl group. The presence of the oxime functional group, derived from the reaction of an aldehyde or ketone with hydroxylamine, imparts specific reactivity and properties to the molecule. This compound is likely to exhibit moderate polarity due to the presence of both aromatic and heteroaromatic systems, which can influence its solubility in various solvents. The bromine substituent on the phenyl ring may enhance the compound's reactivity and can also affect its electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the thienyl moiety can contribute to the compound's biological activity, as many thienyl derivatives are known for their pharmacological properties. Overall, 1-[5-(3-Bromophenyl)-2-thienyl]ethanone oxime represents a complex structure with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₂H₁₀BrNOS

InChI: InChI=1S/C12H10BrNOS/c1-8(14-15)11-5-6-12(16-11)9-3-2-4-10(13)7-9/h2-7,15H,1H3

InChI key: InChIKey=CDOPOEQLJGROKQ-UHFFFAOYSA-N

SMILES: C(=NO)(C)C=1SC(=CC1)C2=CC(Br)=CC=C2

Synonyms:

• 1-[5-(3-Bromophenyl)-2-thienyl]ethanone oxime
• Ethanone, 1-[5-(3-bromophenyl)-2-thienyl]-, oxime

N-{1-[5-(3-Bromophenyl)thiophen-2-yl]ethylidene}hydroxylamine, somers

CAS: 1118787-06-6

Versatile small molecule scaffold

Formula: C₁₂H₁₀BrNOS

Purity: Min. 95%

Molecular weight: 296.18 g/mol

Ref: 3D-TUB78706