
CAS 1118787-07-7
:1,1-Dimethylethyl 4-(aminomethyl)-4-(cyclopropylamino)-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-(aminomethyl)-4-(cyclopropylamino)-1-piperidinecarboxylate, identified by its CAS number 1118787-07-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with both an aminomethyl group and a cyclopropylamino group. This compound features a tert-butyl group (1,1-dimethylethyl) that enhances its steric properties, potentially influencing its biological activity and solubility. The presence of the carboxylate functional group suggests that it may exhibit acidic properties, which can affect its reactivity and interactions with other molecules. Additionally, the cyclopropyl group may contribute to unique conformational characteristics, impacting the compound's pharmacological profile. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Overall, the structural complexity and functional groups present in this compound make it a subject of interest for further research in chemical and biological contexts.
Formula:C14H27N3O2
InChI:InChI=1S/C14H27N3O2/c1-13(2,3)19-12(18)17-8-6-14(10-15,7-9-17)16-11-4-5-11/h11,16H,4-10,15H2,1-3H3
InChI key:InChIKey=FBYGCVIKKILWIR-UHFFFAOYSA-N
SMILES:N(C1(CN)CCN(C(OC(C)(C)C)=O)CC1)C2CC2
Synonyms:- 1,1-Dimethylethyl 4-(aminomethyl)-4-(cyclopropylamino)-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-(aminomethyl)-4-(cyclopropylamino)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.