CAS 1118787-10-2

4-Chloro-5-nitro-1H-pyrrole-2-carboxylic acid

Description:

4-Chloro-5-nitro-1H-pyrrole-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. The presence of a chloro group at the 4-position and a nitro group at the 5-position contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents, making it useful in synthetic organic chemistry. This compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, and the presence of halogen and nitro substituents can influence its electronic properties and reactivity. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 4-Chloro-5-nitro-1H-pyrrole-2-carboxylic acid is a versatile compound with potential applications in both research and industry.

Formula: C₅H₃ClN₂O₄

InChI: InChI=1S/C5H3ClN2O4/c6-2-1-3(5(9)10)7-4(2)8(11)12/h1,7H,(H,9,10)

InChI key: InChIKey=LUHFMJNZRSMDEI-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1NC(N(=O)=O)=C(Cl)C1

Synonyms:

• 4-Chloro-5-nitro-1H-pyrrole-2-carboxylic acid
• 1H-Pyrrole-2-carboxylic acid, 4-chloro-5-nitro-