CAS 1118787-12-4

1,6-Dihydro-4-methyl-6-oxo-2-(3-pyridinyl)-5-pyrimidineacetic acid

Description:

1,6-Dihydro-4-methyl-6-oxo-2-(3-pyridinyl)-5-pyrimidineacetic acid is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of carboxylic acid functional groups. The presence of the pyridine ring may impart basic characteristics, while the pyrimidine structure contributes to its potential biological activity. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyrimidines and pyridines are often explored for their pharmacological properties. Additionally, its molecular structure suggests it may participate in various chemical reactions, including those typical of carboxylic acids and ketones. Overall, the specific characteristics, including melting point, boiling point, and reactivity, would require empirical data for precise determination.

Formula: C₁₂H₁₁N₃O₃

InChI: InChI=1S/C12H11N3O3/c1-7-9(5-10(16)17)12(18)15-11(14-7)8-3-2-4-13-6-8/h2-4,6H,5H2,1H3,(H,16,17)(H,14,15,18)

InChI key: InChIKey=VKYPUUGAULWRSS-UHFFFAOYSA-N

SMILES: CC=1NC(=NC(=O)C1CC(O)=O)C=2C=CC=NC2

Synonyms:

• 1,6-Dihydro-4-methyl-6-oxo-2-(3-pyridinyl)-5-pyrimidineacetic acid
• 5-Pyrimidineacetic acid, 1,6-dihydro-4-methyl-6-oxo-2-(3-pyridinyl)-