CAS 1118787-16-8
:α-[(4-Fluorophenyl)methyl]-5-methyl-1H-tetrazole-1-acetic acid
Description:
α-[(4-Fluorophenyl)methyl]-5-methyl-1H-tetrazole-1-acetic acid is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a 4-fluorobenzyl group, contributing to its lipophilicity and potential biological activity. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, which can influence its solubility and reactivity in various environments. The methyl group at the 5-position of the tetrazole ring can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets. This compound may be of interest in medicinal chemistry due to its unique structure, which could lead to specific pharmacological effects. Its CAS number, 1118787-16-8, allows for precise identification in chemical databases, facilitating research and development in various applications, including pharmaceuticals and agrochemicals. Overall, the combination of functional groups and structural features makes this compound a subject of interest for further study.
Formula:C11H11FN4O2
InChI:InChI=1S/C11H11FN4O2/c1-7-13-14-15-16(7)10(11(17)18)6-8-2-4-9(12)5-3-8/h2-5,10H,6H2,1H3,(H,17,18)
InChI key:InChIKey=HGXHEJIMLZVGRV-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(F)C=C1)(C(O)=O)N2C(C)=NN=N2
Synonyms:- 1H-Tetrazole-1-acetic acid, α-[(4-fluorophenyl)methyl]-5-methyl-
- α-[(4-Fluorophenyl)methyl]-5-methyl-1H-tetrazole-1-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(4-Fluorophenyl)-2-(5-methyl-1H-1,2,3,4-tetrazol-1-yl)propanoic acid
CAS:Controlled Product3-(4-Fluorophenyl)-2-(5-methyl-1H-1,2,3,4-tetrazol-1-yl)propanoic acid is a potent and selective activator of the glycine receptor. It binds to the glycine site on the GABAA receptor and increases chloride conductance. 3-(4-Fluorophenyl)-2-(5-methyl-1H-1,2,3,4-tetrazol-1-yl)propanoic acid has been shown to possess a high affinity for the glycine receptor. This compound is an inhibitor of ion channels such as voltage gated sodium channels and calcium channels. 3-(4 - Fluorophenyl)-2-(5 -methyl - 1H - 1,2,3,4 - tetrazol - 1 - yl)propanoic acid is an excellent research tool for studying cell biology and receptor binding.Formula:C11H11FN4O2Purity:Min. 95%Molecular weight:250.23 g/mol
