CAS 111886-03-4

2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentafluorophenyl ester, homopolymer

Description:

2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentafluorophenyl ester, homopolymer, commonly referred to as a fluorinated polymer, exhibits several notable characteristics. This polymer is derived from the polymerization of a fluorinated monomer, which imparts unique properties such as high chemical resistance, thermal stability, and low surface energy. The presence of multiple fluorine atoms enhances its hydrophobicity and oleophobicity, making it suitable for applications in coatings and materials that require non-stick or water-repellent surfaces. Additionally, the polymer's structure contributes to its mechanical strength and durability, making it useful in various industrial applications. Its fluorinated nature also allows for potential use in electronic and optical applications due to its dielectric properties. However, the environmental impact of fluorinated compounds is a consideration, as they can persist in the environment and may have regulatory implications. Overall, this polymer is valued for its specialized properties in advanced material science and engineering applications.

Formula: (C₁₀H₅F₅O₂)x

InChI: InChI=1S/C10H5F5O2/c1-3(2)10(16)17-9-7(14)5(12)4(11)6(13)8(9)15/h1H2,2H3

InChI key: InChIKey=NIJWSVFNELSKMF-UHFFFAOYSA-N

SMILES: O(C(C(C)=C)=O)C1=C(F)C(F)=C(F)C(F)=C1F

Synonyms:

• Pentafluorophenyl methacrylate homopolymer
• 2-Propenoic acid, 2-methyl-, pentafluorophenyl ester, homopolymer
• Poly(pentafluorophenyl methacrylate)
• 2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentafluorophenyl ester, homopolymer

2-Propenoic acid, 2-methyl-, 2,3,4,5,6-pentafluorophenyl ester, homopolymer

CAS: 111886-03-4

Formula: C₁₀H₅F₅O₂

Molecular weight: 252.1375

Ref: IN-DA01X3PC