CAS 111887-71-9

Pyridine, 2-fluoro-3,5-dimethyl- (9CI)

Description:

Pyridine, 2-fluoro-3,5-dimethyl- (CAS 111887-71-9) is a heterocyclic aromatic compound characterized by a six-membered ring containing five carbon atoms and one nitrogen atom. The presence of a fluorine atom at the 2-position and two methyl groups at the 3 and 5 positions contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor, reminiscent of pyridine. It is polar and can engage in hydrogen bonding due to the nitrogen atom, which can also influence its reactivity and solubility in various solvents. Pyridine derivatives are often used in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic reactions. The presence of the fluorine atom can enhance the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Safety considerations include its potential toxicity and irritant properties, necessitating appropriate handling and storage measures.

Formula: C₇H₈FN

InChI: InChI=1/C7H8FN/c1-5-3-6(2)7(8)9-4-5/h3-4H,1-2H3

SMILES: Cc1cc(C)c(F)nc1

Synonyms:

• 2-Fluoro-3,5-dimethylpyridine

Pyridine, 2-fluoro-3,5-dimethyl- (9CI)

CAS: 111887-71-9

Formula: C₇H₈FN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 125.1435

Ref: IN-DA008XTH

3,5-Dimethyl-2-fluoropyridine

CAS: 111887-71-9

3,5-Dimethyl-2-fluoropyridine

Purity: 95%

Molecular weight: 125.14g/mol

Ref: 54-PC6839

2-Fluoro-3,5-dimethylpyridine

CAS: 111887-71-9

Purity: 98%

Molecular weight: 125.1460037

Ref: 10-F632632