CymitQuimica logo

CAS 111896-68-5

:

4-Chloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine

Description:
4-Chloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a thiopyrano and pyrimidine moiety. The presence of a chlorine atom at the 4-position contributes to its reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents, which can vary based on the specific solvent used. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the thiopyrano and pyrimidine rings, which are often associated with various biological activities. The compound may also display interesting electronic properties due to the conjugation within its structure. Additionally, it is important to handle this substance with care, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 4-Chloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine represents a valuable compound for further research in organic synthesis and drug development.
Formula:C7H7ClN2S
InChI:InChI=1S/C7H7ClN2S/c8-7-6-5(9-4-10-7)2-1-3-11-6/h4H,1-3H2
InChI key:InChIKey=IHWHZUYYJJSKAF-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=N1)CCCS2
Synonyms:
  • 6H-Thiopyrano[3,2-d]pyrimidine, 4-chloro-7,8-dihydro-
  • 4-Chloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.