CAS 111897-35-9: (6α,11β,16α)-9-Fluoro-6,11,17,21-tetrahydroxy-16-methylpregna-1,4-diene-3,20-dione

Description:The chemical substance known as (6α,11β,16α)-9-Fluoro-6,11,17,21-tetrahydroxy-16-methylpregna-1,4-diene-3,20-dione, with the CAS number 111897-35-9, is a synthetic corticosteroid. It is characterized by its complex steroid structure, which includes multiple hydroxyl groups and a fluorine atom, contributing to its biological activity. This compound exhibits anti-inflammatory and immunosuppressive properties, making it useful in various therapeutic applications, particularly in the treatment of conditions such as asthma, allergies, and autoimmune disorders. The presence of the fluorine atom enhances its potency and metabolic stability compared to other corticosteroids. Additionally, the specific stereochemistry of the molecule influences its interaction with glucocorticoid receptors, affecting its efficacy and side effect profile. As with many corticosteroids, careful consideration of dosage and duration of use is essential to minimize potential adverse effects, such as hormonal imbalances or increased susceptibility to infections. Overall, this compound represents a significant advancement in corticosteroid pharmacology.

Formula:C₂₂H₂₉FO₆

InChI:InChI=1S/C22H29FO6/c1-11-6-13-14-8-16(26)15-7-12(25)4-5-19(15,2)21(14,23)17(27)9-20(13,3)22(11,29)18(28)10-24/h4-5,7,11,13-14,16-17,24,26-27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1

InChI key:InChIKey=RVBSTEHLLHXILB-GQKYHHCASA-N

SMILES:O=C1C=CC2(C(=C1)C(O)CC3C4CC(C)C(O)(C(=O)CO)C4(C)CC(O)C32F)C