CAS 111897-99-5
:o-Cresol -D-Glucuronide
Description:
o-Cresol-D-Glucuronide is a chemical compound that is a glucuronide conjugate of o-cresol, which is a methyl-substituted phenol. This compound is typically formed in the body as a result of the metabolism of o-cresol, where the hydroxyl group of o-cresol undergoes conjugation with glucuronic acid, facilitating its excretion. It is characterized by its solubility in water due to the polar glucuronide moiety, which enhances its bioavailability and elimination from biological systems. The compound is often studied in the context of pharmacokinetics and toxicology, as it can serve as a biomarker for exposure to cresol and related compounds. Additionally, o-Cresol-D-Glucuronide may exhibit varying degrees of biological activity, depending on the context of its formation and the specific metabolic pathways involved. Its analysis can be performed using techniques such as liquid chromatography coupled with mass spectrometry (LC-MS), which allows for sensitive detection and quantification in biological samples.
Formula:C13H16O7
InChI:InChI=1/C13H16O7/c1-6-4-2-3-5-7(6)19-13-10(16)8(14)9(15)11(20-13)12(17)18/h2-5,8-11,13-16H,1H3,(H,17,18)/t8-,9-,10-,11?,13+/m1/s1
Synonyms:- 2-Methylphenyl -D-Glucopyranosiduronic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
o-Cresol β-D-Glucuronide
CAS:Controlled ProductApplications A metabolite of o-Cresol.
References Goerge, G., et al.: Xenobiotica, 17, 1293 (1987),Formula:C13H16O7Color and Shape:NeatMolecular weight:284.26o-Cresol-d7 β-D-Glucuronide
CAS:Controlled ProductFormula:C13D7H9O7Color and Shape:NeatMolecular weight:291.305

