CAS 111902-03-5

3,6-di-O-(tert-butyldimethylsilyl)-D-galactal

Description:

3,6-di-O-(tert-butyldimethylsilyl)-D-galactal is a chemical compound that belongs to the class of galactose derivatives, specifically modified sugars. It features two tert-butyldimethylsilyl (TBDMS) protecting groups on the hydroxyl groups at the 3 and 6 positions of the D-galactal structure. This modification enhances the compound's stability and solubility, making it useful in organic synthesis and carbohydrate chemistry. The presence of silyl groups typically allows for selective deprotection reactions, facilitating further functionalization of the sugar moiety. The compound is often utilized in the synthesis of more complex carbohydrates and glycosides, serving as an intermediate in various chemical reactions. Its CAS number, 111902-03-5, uniquely identifies this specific compound in chemical databases, aiding in its identification and research. Overall, 3,6-di-O-(tert-butyldimethylsilyl)-D-galactal is significant in synthetic organic chemistry, particularly in the study and manipulation of carbohydrate structures.

Formula: C₁₈H₃₈O₄Si₂

InChI: InChI=1/C18H38O4Si2/c1-17(2,3)23(7,8)21-13-15-16(19)14(11-12-20-15)22-24(9,10)18(4,5)6/h11-12,14-16,19H,13H2,1-10H3/t14-,15-,16-/m1/s1

SMILES: CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H]([C@@H](C=CO1)O[Si](C)(C)C(C)(C)C)O

3,6-DI-O-TERT-BUTYLDIMETHYLSILYL-D-GALACTAL

CAS: 111902-03-5

Formula: C₁₈H₃₈O₄Si₂

Purity: 95.0%

Molecular weight: 374.668

Ref: 10-F471293

3,6-Di-O-tert-butyldimethylsilyl-D-galactal

CAS: 111902-03-5

3,6-Di-O-tert-butyldimethylsilyl-D-galactal is a sugar that has been modified with fluorination. This sugar can be used as an intermediate for the synthesis of complex carbohydrate or glycosylation. 3,6-Di-O-tert-butyldimethylsilyl-D-galactal can also be used in Click chemistry to modify proteins and polysaccharides. This product is offered at high purity and custom synthesis.

Purity: Min. 95%

Ref: 3D-MD05337