CAS 111935-92-3
:4-{[5-(naphthalen-2-yloxy)pentyl]oxy}aniline
Description:
4-{[5-(Naphthalen-2-yloxy)pentyl]oxy}aniline, with the CAS number 111935-92-3, is an organic compound characterized by its complex structure that includes an aniline moiety and a naphthyl group linked through a pentyl ether. This compound features a naphthalene ring, which contributes to its aromatic properties, and an ether linkage that enhances its solubility in organic solvents. The presence of the aniline group suggests potential applications in dye synthesis or as a precursor in organic synthesis due to its nucleophilic nature. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems. Its molecular structure indicates potential for interactions in biological systems, making it a candidate for research in medicinal chemistry or materials science. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C21H23NO2
InChI:InChI=1/C21H23NO2/c22-19-9-12-20(13-10-19)23-14-4-1-5-15-24-21-11-8-17-6-2-3-7-18(17)16-21/h2-3,6-13,16H,1,4-5,14-15,22H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aniline, p-(5-(2-naphthyloxy)pentyloxy)-
CAS:Aniline, p-(5-(2-naphthyloxy)pentyloxy)- is a bioactive chemical.Formula:C21H23NO2Color and Shape:SolidMolecular weight:321.41
