CAS 1119449-39-6

5-(4-Bromophenyl)-2-chloro-3-pyridinecarboxaldehyde

Description:

5-(4-Bromophenyl)-2-chloro-3-pyridinecarboxaldehyde is an organic compound characterized by its complex structure, which includes a pyridine ring, a bromophenyl group, and a chloro substituent. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential biological activity, which could be explored in medicinal chemistry. The bromine and chlorine substituents can influence the compound's reactivity and solubility, making it a subject of interest in research. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other reagents. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound exemplifies the complexity and utility of halogenated aromatic aldehydes in chemical research and applications.

Formula: C₁₂H₇BrClNO

InChI: InChI=1S/C12H7BrClNO/c13-11-3-1-8(2-4-11)9-5-10(7-16)12(14)15-6-9/h1-7H

InChI key: InChIKey=ONLSOUWWZPSWCK-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CN=C1Cl)C2=CC=C(Br)C=C2

Synonyms:

• 5-(4-Bromophenyl)-2-chloro-3-pyridinecarboxaldehyde
• 3-Pyridinecarboxaldehyde, 5-(4-bromophenyl)-2-chloro-

5-(4-Bromophenyl)-2-chloropyridine-3-carboxaldehyde

CAS: 1119449-39-6

Formula: C₁₂H₇BrClNO

Color and Shape: Solid

Molecular weight: 296.5471

Ref: IN-DA003M54