CAS 1119449-40-9: 9H-Fluoren-9-ylmethyl 3-oxo-1-piperazinecarboxylate

Description:9H-Fluoren-9-ylmethyl 3-oxo-1-piperazinecarboxylate is a chemical compound characterized by its complex structure, which includes a fluorenyl group, a piperazine moiety, and a carboxylate functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry and drug development. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in pharmacological studies. Additionally, the carbonyl group (3-oxo) enhances its reactivity, allowing for various chemical transformations. The compound is likely to be soluble in organic solvents, reflecting its hydrophobic fluorenyl component, while the carboxylate may impart some degree of polarity. Overall, 9H-Fluoren-9-ylmethyl 3-oxo-1-piperazinecarboxylate represents a versatile scaffold for further chemical modifications and investigations into its biological activity.

Formula:C₁₉H₁₈N₂O₃

InChI:InChI=1S/C19H18N2O3/c22-18-11-21(10-9-20-18)19(23)24-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17H,9-12H2,(H,20,22)

InChI key:InChIKey=YQKHEDWUIMBPKY-UHFFFAOYSA-N

SMILES:O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)N4CC(=O)NCC4

Synonyms:
9H-Fluoren-9-ylmethyl 3-oxo-1-piperazinecarboxylate
1-Piperazinecarboxylic acid, 3-oxo-, 9H-fluoren-9-ylmethyl ester
1-Fmoc-3-oxopiperazine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-Fmoc-3-Oxopiperazine REF: 54-OR309133CAS: 1119449-40-9	0.99	32.00 €~990.00 €	Tue 04 Mar 25
(9H-fluoren-9-yl)methyl 3-oxopiperazine-1-carboxylate REF: 10-F766088CAS: 1119449-40-9	98%	To inquire	Thu 13 Mar 25
1-Fmoc-3-piperazinone REF: IN-DA0090AQCAS: 1119449-40-9	98%	- - -	Discontinued product
(9H-Fluoren-9-yl)methyl 3-oxopiperazine-1-carboxylate REF: 3D-UUB44940CAS: 1119449-40-9	Min. 95%	- - -	Discontinued product