CAS 1119449-44-3
:6-Methyl-2-(3-piperidinyl)benzoxazole
Description:
6-Methyl-2-(3-piperidinyl)benzoxazole is a chemical compound characterized by its unique structure, which includes a benzoxazole ring fused with a piperidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen atoms in its structure. The methyl group at the 6-position of the benzoxazole ring can influence its solubility and reactivity, while the piperidine group may contribute to its pharmacological properties. Compounds like this are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of both aromatic and aliphatic components in its structure may also suggest interesting interactions with biological targets. Overall, 6-Methyl-2-(3-piperidinyl)benzoxazole represents a class of compounds that could be of interest in drug discovery and development, although specific biological activities and applications would require further investigation.
Formula:C13H16N2O
InChI:InChI=1S/C13H16N2O/c1-9-4-5-11-12(7-9)16-13(15-11)10-3-2-6-14-8-10/h4-5,7,10,14H,2-3,6,8H2,1H3
InChI key:InChIKey=XNYGWJNYUFAOLM-UHFFFAOYSA-N
SMILES:CC=1C=C2OC(=NC2=CC1)C3CCCNC3
Synonyms:- Benzoxazole, 6-methyl-2-(3-piperidinyl)-
- 6-Methyl-2-(3-piperidinyl)benzoxazole
- 6-methyl-2-piperidin-3-yl-1,3-benzoxazole
- 6-Methyl-2-(piperidin-3-yl)benzo[d]oxazole hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.