CAS 1119449-45-4
:5-(1,1-Dimethylethyl)-2-benzoxazolemethanamine
Description:
5-(1,1-Dimethylethyl)-2-benzoxazolemethanamine, identified by its CAS number 1119449-45-4, is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the bulky 1,1-dimethylethyl group enhances its steric hindrance, which can influence its interaction with other molecules and its overall stability. Benzoxazole derivatives are often noted for their biological activity, including potential applications in pharmaceuticals and agrochemicals. The amine group may also impart basicity, affecting its behavior in various chemical environments. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would be essential for understanding its applications and behavior in chemical reactions. Further studies would be necessary to explore its full range of properties and potential uses in various fields.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c1-12(2,3)8-4-5-10-9(6-8)14-11(7-13)15-10/h4-6H,7,13H2,1-3H3
InChI key:InChIKey=SIHHRUINFFFVPO-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C=C2C(OC(CN)=N2)=CC1
Synonyms:- 5-(1,1-Dimethylethyl)-2-benzoxazolemethanamine
- (5-tert-Butyl-1,3-benzoxazol-2-yl)methylamine
- 2-Benzoxazolemethanamine, 5-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.