CAS 1119449-46-5

2,4-Dichloro-N-(3-nitrophenyl)benzenemethanamine

Description:

2,4-Dichloro-N-(3-nitrophenyl)benzenemethanamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two chlorine atoms and an amine group, as well as a nitrophenyl group. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of both the amine and nitro functional groups. The dichloro substitution can influence its electronic properties, potentially affecting its reactivity and interaction with biological systems. It may be used in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. However, due to the presence of chlorine and nitro groups, it may also pose environmental and health risks, necessitating careful handling and disposal. As with many chemical substances, understanding its behavior in different environments, including its stability and potential for degradation, is crucial for safe use and application.

Formula: C₁₃H₁₀Cl₂N₂O₂

InChI: InChI=1S/C13H10Cl2N2O2/c14-10-5-4-9(13(15)6-10)8-16-11-2-1-3-12(7-11)17(18)19/h1-7,16H,8H2

InChI key: InChIKey=ISZOLSBJININMM-UHFFFAOYSA-N

SMILES: N(CC1=C(Cl)C=C(Cl)C=C1)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• 2,4-Dichloro-N-(3-nitrophenyl)benzenemethanamine
• Benzenemethanamine, 2,4-dichloro-N-(3-nitrophenyl)-