CAS 1119449-54-5
:3-[5-[(Propylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide
Description:
3-[5-[(Propylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide, with the CAS number 1119449-54-5, is a chemical compound that features a benzamide structure substituted with a 1,2,4-oxadiazole moiety. This compound typically exhibits characteristics such as moderate solubility in polar solvents, which is influenced by the presence of both the amide and oxadiazole functional groups. The oxadiazole ring contributes to its potential biological activity, as compounds containing this heterocyclic structure are often investigated for pharmacological properties. The propylamino group enhances the compound's ability to interact with biological targets, potentially influencing its efficacy and selectivity. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a candidate for further synthetic modifications. Overall, this compound's unique structural features position it as a subject of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents.
Formula:C13H16N4O2
InChI:InChI=1S/C13H16N4O2/c1-2-6-15-8-11-16-13(17-19-11)10-5-3-4-9(7-10)12(14)18/h3-5,7,15H,2,6,8H2,1H3,(H2,14,18)
InChI key:InChIKey=SSRBVENDMFAUHG-UHFFFAOYSA-N
SMILES:C(NCCC)C1=NC(=NO1)C2=CC(C(N)=O)=CC=C2
Synonyms:- Benzamide, 3-[5-[(propylamino)methyl]-1,2,4-oxadiazol-3-yl]-
- 3-[5-[(Propylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.