CAS 1119449-60-3
:3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)-N-propylbenzamide
Description:
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)-N-propylbenzamide is a chemical compound characterized by its unique structure, which includes an oxadiazole ring, a chloromethyl group, and a benzamide moiety. The presence of the oxadiazole ring suggests potential biological activity, as such heterocycles are often associated with pharmacological properties. The chloromethyl group may enhance reactivity, allowing for further chemical modifications or interactions. The N-(1-methylethyl) and N-propyl substituents on the benzamide indicate that this compound may exhibit lipophilic characteristics, potentially influencing its solubility and permeability in biological systems. Additionally, the compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are critical for its biological activity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific biological activities, toxicity, and stability would require further investigation through experimental studies.
Formula:C16H20ClN3O2
InChI:InChI=1S/C16H20ClN3O2/c1-4-8-20(11(2)3)16(21)13-7-5-6-12(9-13)15-18-14(10-17)22-19-15/h5-7,9,11H,4,8,10H2,1-3H3
InChI key:InChIKey=BSZYKMVHHGJYES-UHFFFAOYSA-N
SMILES:C(N(CCC)C(C)C)(=O)C=1C=C(C=CC1)C=2N=C(CCl)ON2
Synonyms:- 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)-N-propylbenzamide
- Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.